C20H25F3N6O2 — CID 10026124
7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-tert-butyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide (PubChem CID 10026124) has the molecular formula C20H25F3N6O2 and a molecular weight of 438.45 g/mol. Its IUPAC name is 7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-tert-butyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide.
| Compound Name | 7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-tert-butyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 10026124 |
| Molecular Formula | C20H25F3N6O2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-tert-butyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1nnc2n1CCN(C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F)C2 |
| InChI | InChI=1S/C20H25F3N6O2/c1-20(2,3)25-19(31)18-27-26-16-10-28(4-5-29(16)18)17(30)8-12(24)6-11-7-14(22)15(23)9-13(11)21/h7,9,12H,4-6,8,10,24H2,1-3H3,(H,25,31)/t12-/m1/s1 |
| InChIKey | BCCRFONTJXIFPI-GFCCVEGCSA-N |
| XLogP | 1.53 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|