C27H32N4O2 — CID 10026498
6,8-dimethyl-3,13-bis(2,4,6-trimethylphenyl)-5,11-dioxa-1,2,4,12-tetrazatricyclo[8.3.0.02,6]trideca-3,7,12-triene (PubChem CID 10026498) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 6,8-dimethyl-3,13-bis(2,4,6-trimethylphenyl)-5,11-dioxa-1,2,4,12-tetrazatricyclo[8.3.0.02,6]trideca-3,7,12-triene.
| Compound Name | 6,8-dimethyl-3,13-bis(2,4,6-trimethylphenyl)-5,11-dioxa-1,2,4,12-tetrazatricyclo[8.3.0.02,6]trideca-3,7,12-triene |
|---|---|
| PubChem CID | 10026498 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 6,8-dimethyl-3,13-bis(2,4,6-trimethylphenyl)-5,11-dioxa-1,2,4,12-tetrazatricyclo[8.3.0.02,6]trideca-3,7,12-triene |
| SMILES | CC1=CC2(C)ON=C(c3c(C)cc(C)cc3C)N2N2C(c3c(C)cc(C)cc3C)=NOC2C1 |
| InChI | InChI=1S/C27H32N4O2/c1-15-9-18(4)23(19(5)10-15)25-28-32-22-13-17(3)14-27(8)31(30(22)25)26(29-33-27)24-20(6)11-16(2)12-21(24)7/h9-12,14,22H,13H2,1-8H3 |
| InChIKey | AACGOTXBLDWDFT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|