C27H34N4O2 — CID 14642129
1,3-dimethyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene (PubChem CID 14642129) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 1,3-dimethyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene.
| Compound Name | 1,3-dimethyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene |
|---|---|
| PubChem CID | 14642129 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 1,3-dimethyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene |
| SMILES | Cc1cc(C)c(C2=NOC3(C)CC4(C)ON=C(c5c(C)cc(C)cc5C)N4CCN23)c(C)c1 |
| InChI | InChI=1S/C27H34N4O2/c1-16-11-18(3)22(19(4)12-16)24-28-32-26(7)15-27(8)31(10-9-30(24)26)25(29-33-27)23-20(5)13-17(2)14-21(23)6/h11-14H,9-10,15H2,1-8H3 |
| InChIKey | JHCJWCJXZQIVGD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |