C28H36N4O2 — CID 11374600
(5S,9'aS)-7',9'a-dimethyl-3,3'-bis(2,4,6-trimethylphenyl)spiro[4H-1,2-oxazole-5,8'-6,9-dihydro-5H-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine] (PubChem CID 11374600) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is (5S,9'aS)-7',9'a-dimethyl-3,3'-bis(2,4,6-trimethylphenyl)spiro[4H-1,2-oxazole-5,8'-6,9-dihydro-5H-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine].
| Compound Name | (5S,9'aS)-7',9'a-dimethyl-3,3'-bis(2,4,6-trimethylphenyl)spiro[4H-1,2-oxazole-5,8'-6,9-dihydro-5H-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine] |
|---|---|
| PubChem CID | 11374600 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (5S,9'aS)-7',9'a-dimethyl-3,3'-bis(2,4,6-trimethylphenyl)spiro[4H-1,2-oxazole-5,8'-6,9-dihydro-5H-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine] |
| SMILES | Cc1cc(C)c(C2=NO[C@@]3(C2)C[C@]2(C)ON=C(c4c(C)cc(C)cc4C)N2CCN3C)c(C)c1 |
| InChI | InChI=1S/C28H36N4O2/c1-17-11-19(3)24(20(4)12-17)23-15-28(34-29-23)16-27(7)32(10-9-31(28)8)26(30-33-27)25-21(5)13-18(2)14-22(25)6/h11-14H,9-10,15-16H2,1-8H3/t27-,28-/m0/s1 |
| InChIKey | UJVMREWFNTWUOH-NSOVKSMOSA-N |
| XLogP | 5.10 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |