C37H38N4O2 — CID 14642136
(1R,3R)-1,3-diphenyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene (PubChem CID 14642136) has the molecular formula C37H38N4O2 and a molecular weight of 570.74 g/mol. Its IUPAC name is (1R,3R)-1,3-diphenyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene.
| Compound Name | (1R,3R)-1,3-diphenyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene |
|---|---|
| PubChem CID | 14642136 |
| Molecular Formula | C37H38N4O2 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | (1R,3R)-1,3-diphenyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene |
| SMILES | Cc1cc(C)c(C2=NO[C@@]3(c4ccccc4)C[C@]4(c5ccccc5)ON=C(c5c(C)cc(C)cc5C)N4CCN23)c(C)c1 |
| InChI | InChI=1S/C37H38N4O2/c1-24-19-26(3)32(27(4)20-24)34-38-42-36(30-13-9-7-10-14-30)23-37(31-15-11-8-12-16-31)41(18-17-40(34)36)35(39-43-37)33-28(5)21-25(2)22-29(33)6/h7-16,19-22H,17-18,23H2,1-6H3/t36-,37-/m1/s1 |
| InChIKey | JXFVCILKBUVJEG-FZNHDDJXSA-N |
| XLogP | 7.33 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |