C28H29N3O — CID 14913496
7-methyl-8,9a-diphenyl-3-(2,4,6-trimethylphenyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine (PubChem CID 14913496) has the molecular formula C28H29N3O and a molecular weight of 423.56 g/mol. Its IUPAC name is 7-methyl-8,9a-diphenyl-3-(2,4,6-trimethylphenyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine.
| Compound Name | 7-methyl-8,9a-diphenyl-3-(2,4,6-trimethylphenyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine |
|---|---|
| PubChem CID | 14913496 |
| Molecular Formula | C28H29N3O |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 7-methyl-8,9a-diphenyl-3-(2,4,6-trimethylphenyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine |
| SMILES | Cc1cc(C)c(C2=NOC3(c4ccccc4)C=C(c4ccccc4)N(C)CCN23)c(C)c1 |
| InChI | InChI=1S/C28H29N3O/c1-20-17-21(2)26(22(3)18-20)27-29-32-28(24-13-9-6-10-14-24)19-25(23-11-7-5-8-12-23)30(4)15-16-31(27)28/h5-14,17-19H,15-16H2,1-4H3 |
| InChIKey | MKQJQLFKESJBPY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |