C20H18F3N3O — CID 14913499
7-methyl-8,9a-diphenyl-3-(trifluoromethyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine (PubChem CID 14913499) has the molecular formula C20H18F3N3O and a molecular weight of 373.38 g/mol. Its IUPAC name is 7-methyl-8,9a-diphenyl-3-(trifluoromethyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine.
| Compound Name | 7-methyl-8,9a-diphenyl-3-(trifluoromethyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine |
|---|---|
| PubChem CID | 14913499 |
| Molecular Formula | C20H18F3N3O |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 7-methyl-8,9a-diphenyl-3-(trifluoromethyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine |
| SMILES | CN1CCN2C(C(F)(F)F)=NOC2(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C20H18F3N3O/c1-25-12-13-26-18(20(21,22)23)24-27-19(26,16-10-6-3-7-11-16)14-17(25)15-8-4-2-5-9-15/h2-11,14H,12-13H2,1H3 |
| InChIKey | AIRYGRHKLLACSH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |