C18H25N3O — CID 11231859
7,8,9a-trimethyl-3-(2,4,6-trimethylphenyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine (PubChem CID 11231859) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 7,8,9a-trimethyl-3-(2,4,6-trimethylphenyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine.
| Compound Name | 7,8,9a-trimethyl-3-(2,4,6-trimethylphenyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine |
|---|---|
| PubChem CID | 11231859 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 7,8,9a-trimethyl-3-(2,4,6-trimethylphenyl)-5,6-dihydro-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine |
| SMILES | CC1=CC2(C)ON=C(c3c(C)cc(C)cc3C)N2CCN1C |
| InChI | InChI=1S/C18H25N3O/c1-12-9-13(2)16(14(3)10-12)17-19-22-18(5)11-15(4)20(6)7-8-21(17)18/h9-11H,7-8H2,1-6H3 |
| InChIKey | ZQTMZLPFEQYGBB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |