C32H36N4O2 — CID 14642134
(1R,3R)-1-methyl-3-phenyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene (PubChem CID 14642134) has the molecular formula C32H36N4O2 and a molecular weight of 508.67 g/mol. Its IUPAC name is (1R,3R)-1-methyl-3-phenyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene.
| Compound Name | (1R,3R)-1-methyl-3-phenyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene |
|---|---|
| PubChem CID | 14642134 |
| Molecular Formula | C32H36N4O2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | (1R,3R)-1-methyl-3-phenyl-6,11-bis(2,4,6-trimethylphenyl)-4,13-dioxa-5,7,10,12-tetrazatricyclo[8.3.0.03,7]trideca-5,11-diene |
| SMILES | Cc1cc(C)c(C2=NO[C@]3(C)C[C@]4(c5ccccc5)ON=C(c5c(C)cc(C)cc5C)N4CCN23)c(C)c1 |
| InChI | InChI=1S/C32H36N4O2/c1-20-15-22(3)27(23(4)16-20)29-33-37-31(7)19-32(26-11-9-8-10-12-26)36(14-13-35(29)31)30(34-38-32)28-24(5)17-21(2)18-25(28)6/h8-12,15-18H,13-14,19H2,1-7H3/t31-,32-/m1/s1 |
| InChIKey | JYFJPKJRIFAFEF-ROJLCIKYSA-N |
| XLogP | 6.20 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |