C28H36N4O2 — CID 14913500
2,9,10-trimethyl-5,11-bis(2,4,6-trimethylphenyl)-3,13-dioxa-4,6,9,12-tetrazatricyclo[8.3.0.02,6]trideca-4,11-diene (PubChem CID 14913500) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 2,9,10-trimethyl-5,11-bis(2,4,6-trimethylphenyl)-3,13-dioxa-4,6,9,12-tetrazatricyclo[8.3.0.02,6]trideca-4,11-diene.
| Compound Name | 2,9,10-trimethyl-5,11-bis(2,4,6-trimethylphenyl)-3,13-dioxa-4,6,9,12-tetrazatricyclo[8.3.0.02,6]trideca-4,11-diene |
|---|---|
| PubChem CID | 14913500 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 2,9,10-trimethyl-5,11-bis(2,4,6-trimethylphenyl)-3,13-dioxa-4,6,9,12-tetrazatricyclo[8.3.0.02,6]trideca-4,11-diene |
| SMILES | Cc1cc(C)c(C2=NOC3(C)C4ON=C(c5c(C)cc(C)cc5C)C4(C)N(C)CCN23)c(C)c1 |
| InChI | InChI=1S/C28H36N4O2/c1-16-12-18(3)22(19(4)13-16)24-27(7)26(33-29-24)28(8)32(11-10-31(27)9)25(30-34-28)23-20(5)14-17(2)15-21(23)6/h12-15,26H,10-11H2,1-9H3 |
| InChIKey | UWAQJKSGWDLXSG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |