C33H38N4O2 — CID 102021508
(5S,9'aS)-7'-methyl-9'a-phenyl-3,3'-bis(2,4,6-trimethylphenyl)spiro[4H-1,2-oxazole-5,8'-6,9-dihydro-5H-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine] (PubChem CID 102021508) has the molecular formula C33H38N4O2 and a molecular weight of 522.69 g/mol. Its IUPAC name is (5S,9'aS)-7'-methyl-9'a-phenyl-3,3'-bis(2,4,6-trimethylphenyl)spiro[4H-1,2-oxazole-5,8'-6,9-dihydro-5H-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine].
| Compound Name | (5S,9'aS)-7'-methyl-9'a-phenyl-3,3'-bis(2,4,6-trimethylphenyl)spiro[4H-1,2-oxazole-5,8'-6,9-dihydro-5H-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine] |
|---|---|
| PubChem CID | 102021508 |
| Molecular Formula | C33H38N4O2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | (5S,9'aS)-7'-methyl-9'a-phenyl-3,3'-bis(2,4,6-trimethylphenyl)spiro[4H-1,2-oxazole-5,8'-6,9-dihydro-5H-[1,2,4]oxadiazolo[4,5-d][1,4]diazepine] |
| SMILES | Cc1cc(C)c(C2=NO[C@@]3(C2)C[C@@]2(c4ccccc4)ON=C(c4c(C)cc(C)cc4C)N2CCN3C)c(C)c1 |
| InChI | InChI=1S/C33H38N4O2/c1-21-15-23(3)29(24(4)16-21)28-19-32(38-34-28)20-33(27-11-9-8-10-12-27)37(14-13-36(32)7)31(35-39-33)30-25(5)17-22(2)18-26(30)6/h8-12,15-18H,13-14,19-20H2,1-7H3/t32-,33-/m0/s1 |
| InChIKey | KAYMDYHAOVOZBX-LQJZCPKCSA-N |
| XLogP | 6.24 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |