C28H34N4O2 — CID 162812456
(6R,9R,13S)-6,8,13-trimethyl-3,12-bis(2,4,6-trimethylphenyl)-5,10-dioxa-1,2,4,11-tetrazatricyclo[7.3.1.02,6]trideca-3,7,11-triene (PubChem CID 162812456) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is (6R,9R,13S)-6,8,13-trimethyl-3,12-bis(2,4,6-trimethylphenyl)-5,10-dioxa-1,2,4,11-tetrazatricyclo[7.3.1.02,6]trideca-3,7,11-triene.
| Compound Name | (6R,9R,13S)-6,8,13-trimethyl-3,12-bis(2,4,6-trimethylphenyl)-5,10-dioxa-1,2,4,11-tetrazatricyclo[7.3.1.02,6]trideca-3,7,11-triene |
|---|---|
| PubChem CID | 162812456 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | (6R,9R,13S)-6,8,13-trimethyl-3,12-bis(2,4,6-trimethylphenyl)-5,10-dioxa-1,2,4,11-tetrazatricyclo[7.3.1.02,6]trideca-3,7,11-triene |
| SMILES | CC1=C[C@@]2(C)ON=C(c3c(C)cc(C)cc3C)N2N2C(c3c(C)cc(C)cc3C)=NO[C@H]1[C@@H]2C |
| InChI | InChI=1S/C28H34N4O2/c1-15-10-17(3)23(18(4)11-15)26-29-33-25-21(7)14-28(9)32(31(26)22(25)8)27(30-34-28)24-19(5)12-16(2)13-20(24)6/h10-14,22,25H,1-9H3/t22-,25+,28+/m0/s1 |
| InChIKey | KTFXSFJYVWWCQF-UTOLSJPLSA-N |
| XLogP | 5.57 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|