C27H32N4O2 — CID 162813808
(6R,9R)-6,8-dimethyl-3,12-bis(2,4,6-trimethylphenyl)-5,10-dioxa-1,2,4,11-tetrazatricyclo[7.3.1.02,6]trideca-3,7,11-triene (PubChem CID 162813808) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is (6R,9R)-6,8-dimethyl-3,12-bis(2,4,6-trimethylphenyl)-5,10-dioxa-1,2,4,11-tetrazatricyclo[7.3.1.02,6]trideca-3,7,11-triene.
| Compound Name | (6R,9R)-6,8-dimethyl-3,12-bis(2,4,6-trimethylphenyl)-5,10-dioxa-1,2,4,11-tetrazatricyclo[7.3.1.02,6]trideca-3,7,11-triene |
|---|---|
| PubChem CID | 162813808 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (6R,9R)-6,8-dimethyl-3,12-bis(2,4,6-trimethylphenyl)-5,10-dioxa-1,2,4,11-tetrazatricyclo[7.3.1.02,6]trideca-3,7,11-triene |
| SMILES | CC1=C[C@@]2(C)ON=C(c3c(C)cc(C)cc3C)N2N2C[C@@H]1ON=C2c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C27H32N4O2/c1-15-9-17(3)23(18(4)10-15)25-28-32-22-14-30(25)31-26(29-33-27(31,8)13-21(22)7)24-19(5)11-16(2)12-20(24)6/h9-13,22H,14H2,1-8H3/t22-,27+/m0/s1 |
| InChIKey | GVJYHWHQKXVCCA-WXVAWEFUSA-N |
| XLogP | 5.18 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|