C25H28N4O4 — CID 10026678
2-[4-[[[3-(butanoylamino)-2-pyridinyl]amino]methyl]phenyl]-N-(1,2-dihydroxyethyl)benzamide (PubChem CID 10026678) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[4-[[[3-(butanoylamino)-2-pyridinyl]amino]methyl]phenyl]-N-(1,2-dihydroxyethyl)benzamide.
| Compound Name | 2-[4-[[[3-(butanoylamino)-2-pyridinyl]amino]methyl]phenyl]-N-(1,2-dihydroxyethyl)benzamide |
|---|---|
| PubChem CID | 10026678 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-[4-[[[3-(butanoylamino)-2-pyridinyl]amino]methyl]phenyl]-N-(1,2-dihydroxyethyl)benzamide |
| SMILES | CCCC(=O)Nc1cccnc1NCc1ccc(-c2ccccc2C(=O)NC(O)CO)cc1 |
| InChI | InChI=1S/C25H28N4O4/c1-2-6-22(31)28-21-9-5-14-26-24(21)27-15-17-10-12-18(13-11-17)19-7-3-4-8-20(19)25(33)29-23(32)16-30/h3-5,7-14,23,30,32H,2,6,15-16H2,1H3,(H,26,27)(H,28,31)(H,29,33) |
| InChIKey | WYTWEZJXCHOWDY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|