C22H23N5O7 — CID 10027664
(5R)-5-(azidomethyl)-3-[4-[4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]-3-methoxyphenyl]-2-methoxyphenyl]-1,3-oxazolidin-2-one (PubChem CID 10027664) has the molecular formula C22H23N5O7 and a molecular weight of 469.45 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-3-[4-[4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]-3-methoxyphenyl]-2-methoxyphenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(azidomethyl)-3-[4-[4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]-3-methoxyphenyl]-2-methoxyphenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10027664 |
| Molecular Formula | C22H23N5O7 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (5R)-5-(azidomethyl)-3-[4-[4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]-3-methoxyphenyl]-2-methoxyphenyl]-1,3-oxazolidin-2-one |
| SMILES | COc1cc(-c2ccc(N3C[C@H](CN=[N+]=[N-])OC3=O)c(OC)c2)ccc1N1C[C@H](CO)OC1=O |
| InChI | InChI=1S/C22H23N5O7/c1-31-19-7-13(3-5-17(19)26-10-15(9-24-25-23)33-21(26)29)14-4-6-18(20(8-14)32-2)27-11-16(12-28)34-22(27)30/h3-8,15-16,28H,9-12H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | DCHZIDBXHALKNR-JKSUJKDBSA-N |
| XLogP | 3.32 |
| TPSA | 146.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|