About 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide
5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide (PubChem CID 10029095) has the molecular formula C23H25IN2O3
and a molecular weight of 504.37 g/mol. Its IUPAC name is 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide.
Molecular Properties
| Compound Name | 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide |
| PubChem CID | 10029095 |
| Molecular Formula | C23H25IN2O3 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide |
| SMILES | COCc1n(CC2CC(c3ccccc3)(c3ccccc3)C(=O)O2)cc[n+]1C.[I-] |
| InChI | InChI=1S/C23H25N2O3.HI/c1-24-13-14-25(21(24)17-27-2)16-20-15-23(22(26)28-20,18-9-5-3-6-10-18)19-11-7-4-8-12-19;/h3-14,20H,15-17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | TVJOKPAWFUYJMQ-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide?
The IUPAC name of 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide (CID 10029095) is 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide.
What is the SMILES notation for 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide?
The canonical SMILES for 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide is COCc1n(CC2CC(c3ccccc3)(c3ccccc3)C(=O)O2)cc[n+]1C.[I-].
What is the InChIKey of 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide?
The InChIKey is TVJOKPAWFUYJMQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H25N2O3.HI/c1-24-13-14-25(21(24)17-27-2)16-20-15-23(22(26)28-20,18-9-5-3-6-10-18)19-11-7-4-8-12-19;/h3-14,20H,15-17H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide?
5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide has a molecular weight of 504.37 g/mol, XLogP of -0.24, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(methoxymethyl)-3-methylimidazol-3-ium-1-yl]methyl]-3,3-diphenyloxolan-2-one iodide is sourced from PubChem (CID 10029095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).