C21H21BrN2O2 — CID 10093139
5-[(3-methylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one bromide (PubChem CID 10093139) has the molecular formula C21H21BrN2O2 and a molecular weight of 413.32 g/mol. Its IUPAC name is 5-[(3-methylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one bromide.
| Compound Name | 5-[(3-methylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one bromide |
|---|---|
| PubChem CID | 10093139 |
| Molecular Formula | C21H21BrN2O2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 5-[(3-methylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one bromide |
| SMILES | C[n+]1ccn(CC2CC(c3ccccc3)(c3ccccc3)C(=O)O2)c1.[Br-] |
| InChI | InChI=1S/C21H21N2O2.BrH/c1-22-12-13-23(16-22)15-19-14-21(20(24)25-19,17-8-4-2-5-9-17)18-10-6-3-7-11-18;/h2-13,16,19H,14-15H2,1H3;1H/q+1;/p-1 |
| InChIKey | ARQLGHDSLPZPRV-UHFFFAOYSA-M |
| XLogP | -0.38 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|