About chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate
chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate (PubChem CID 67925219) has the molecular formula C21H23ClN2O3
and a molecular weight of 386.88 g/mol. Its IUPAC name is chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate.
Molecular Properties
| Compound Name | chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate |
| PubChem CID | 67925219 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate |
| SMILES | CCl.O.O=C1OC(Cn2cccn2)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O2.CH3Cl.H2O/c23-19-20(16-8-3-1-4-9-16,17-10-5-2-6-11-17)14-18(24-19)15-22-13-7-12-21-22;1-2;/h1-13,18H,14-15H2;1H3;1H2 |
| InChIKey | UAEUFQLMDNAJHS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate?
The IUPAC name of chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate (CID 67925219) is chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate.
What is the SMILES notation for chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate?
The canonical SMILES for chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate is CCl.O.O=C1OC(Cn2cccn2)CC1(c1ccccc1)c1ccccc1.
What is the InChIKey of chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate?
The InChIKey is UAEUFQLMDNAJHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O2.CH3Cl.H2O/c23-19-20(16-8-3-1-4-9-16,17-10-5-2-6-11-17)14-18(24-19)15-22-13-7-12-21-22;1-2;/h1-13,18H,14-15H2;1H3;1H2.
What are the key properties of chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate?
chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate has a molecular weight of 386.88 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;3,3-diphenyl-5-(pyrazol-1-ylmethyl)oxolan-2-one;hydrate is sourced from PubChem (CID 67925219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).