C22H22N2O2 — CID 15016078
5-[(2,5-dimethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one (PubChem CID 15016078) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 5-[(2,5-dimethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one.
| Compound Name | 5-[(2,5-dimethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one |
|---|---|
| PubChem CID | 15016078 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 5-[(2,5-dimethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one |
| SMILES | Cc1cnc(C)n1CC1CC(c2ccccc2)(c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C22H22N2O2/c1-16-14-23-17(2)24(16)15-20-13-22(21(25)26-20,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,14,20H,13,15H2,1-2H3 |
| InChIKey | GVDWOGJDNUIXJE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |