C29H40FN3O2S — CID 10029443
O-[1-cyclohexyl-2-(2-fluorophenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl] N-methylcarbamothioate (PubChem CID 10029443) has the molecular formula C29H40FN3O2S and a molecular weight of 513.72 g/mol. Its IUPAC name is O-[1-cyclohexyl-2-(2-fluorophenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl] N-methylcarbamothioate.
| Compound Name | O-[1-cyclohexyl-2-(2-fluorophenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 10029443 |
| Molecular Formula | C29H40FN3O2S |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | O-[1-cyclohexyl-2-(2-fluorophenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl] N-methylcarbamothioate |
| SMILES | CNC(=S)OC(C1CCCCC1)C(CCN1CCN(c2ccccc2OC)CC1)c1ccccc1F |
| InChI | InChI=1S/C29H40FN3O2S/c1-31-29(36)35-28(22-10-4-3-5-11-22)24(23-12-6-7-13-25(23)30)16-17-32-18-20-33(21-19-32)26-14-8-9-15-27(26)34-2/h6-9,12-15,22,24,28H,3-5,10-11,16-21H2,1-2H3,(H,31,36) |
| InChIKey | XAYIUSLHPVKSJR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|