C30H41FN2O2 — CID 10457886
1-(4-cyclohexyl-3-phenyl-4-prop-2-enoxybutyl)-4-(4-fluoro-2-methoxyphenyl)piperazine (PubChem CID 10457886) has the molecular formula C30H41FN2O2 and a molecular weight of 480.67 g/mol. Its IUPAC name is 1-(4-cyclohexyl-3-phenyl-4-prop-2-enoxybutyl)-4-(4-fluoro-2-methoxyphenyl)piperazine.
| Compound Name | 1-(4-cyclohexyl-3-phenyl-4-prop-2-enoxybutyl)-4-(4-fluoro-2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 10457886 |
| Molecular Formula | C30H41FN2O2 |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 1-(4-cyclohexyl-3-phenyl-4-prop-2-enoxybutyl)-4-(4-fluoro-2-methoxyphenyl)piperazine |
| SMILES | C=CCOC(C1CCCCC1)C(CCN1CCN(c2ccc(F)cc2OC)CC1)c1ccccc1 |
| InChI | InChI=1S/C30H41FN2O2/c1-3-22-35-30(25-12-8-5-9-13-25)27(24-10-6-4-7-11-24)16-17-32-18-20-33(21-19-32)28-15-14-26(31)23-29(28)34-2/h3-4,6-7,10-11,14-15,23,25,27,30H,1,5,8-9,12-13,16-22H2,2H3 |
| InChIKey | BTXASFZJLUROGR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|