C9H15LiO2 — CID 10034908
lithium (5E)-4-(methoxymethoxy)hepta-1,5-diene (PubChem CID 10034908) has the molecular formula C9H15LiO2 and a molecular weight of 162.16 g/mol. Its IUPAC name is lithium (5E)-4-(methoxymethoxy)hepta-1,5-diene.
| Compound Name | lithium (5E)-4-(methoxymethoxy)hepta-1,5-diene |
|---|---|
| PubChem CID | 10034908 |
| Molecular Formula | C9H15LiO2 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | lithium (5E)-4-(methoxymethoxy)hepta-1,5-diene |
| SMILES | C=[C-]CC(/C=C/C)OCOC.[Li+] |
| InChI | InChI=1S/C9H15O2.Li/c1-4-6-9(7-5-2)11-8-10-3;/h5,7,9H,1,6,8H2,2-3H3;/q-1;+1/b7-5+; |
| InChIKey | RZLRDWWOELEPBW-GZOLSCHFSA-N |
| XLogP | -1.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|