C8H16O3 — CID 102077684
(E,4R)-4-(methoxymethoxy)hex-2-en-1-ol (PubChem CID 102077684) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (E,4R)-4-(methoxymethoxy)hex-2-en-1-ol.
| Compound Name | (E,4R)-4-(methoxymethoxy)hex-2-en-1-ol |
|---|---|
| PubChem CID | 102077684 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (E,4R)-4-(methoxymethoxy)hex-2-en-1-ol |
| SMILES | CC[C@H](/C=C/CO)OCOC |
| InChI | InChI=1S/C8H16O3/c1-3-8(5-4-6-9)11-7-10-2/h4-5,8-9H,3,6-7H2,1-2H3/b5-4+/t8-/m1/s1 |
| InChIKey | IZQNUGPOQUBMKU-WTSVBCDHSA-N |
| XLogP | 0.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|