C10H18O3 — CID 129322527
(3S,4S)-3-(methoxymethoxy)-6-methylhepta-1,5-dien-4-ol (PubChem CID 129322527) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (3S,4S)-3-(methoxymethoxy)-6-methylhepta-1,5-dien-4-ol.
| Compound Name | (3S,4S)-3-(methoxymethoxy)-6-methylhepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 129322527 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (3S,4S)-3-(methoxymethoxy)-6-methylhepta-1,5-dien-4-ol |
| SMILES | C=C[C@H](OCOC)[C@@H](O)C=C(C)C |
| InChI | InChI=1S/C10H18O3/c1-5-10(13-7-12-4)9(11)6-8(2)3/h5-6,9-11H,1,7H2,2-4H3/t9-,10-/m0/s1 |
| InChIKey | WPSVDMUPMQPZPG-UWVGGRQHSA-N |
| XLogP | 1.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|