C12H20O3 — CID 16756593
(E,3S)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-ol (PubChem CID 16756593) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (E,3S)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-ol.
| Compound Name | (E,3S)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 16756593 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (E,3S)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-ol |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@H]1/C=C/[C@@H](O)CC |
| InChI | InChI=1S/C12H20O3/c1-5-9(13)7-8-11-10(6-2)14-12(3,4)15-11/h6-11,13H,2,5H2,1,3-4H3/b8-7+/t9-,10-,11-/m0/s1 |
| InChIKey | HCJDIVKBSWIFMI-ZYUZMEKTSA-N |
| XLogP | 2.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|