C10H18O3 — CID 102297137
(2E,4R)-4-(methoxymethoxy)octa-2,7-dien-1-ol (PubChem CID 102297137) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2E,4R)-4-(methoxymethoxy)octa-2,7-dien-1-ol.
| Compound Name | (2E,4R)-4-(methoxymethoxy)octa-2,7-dien-1-ol |
|---|---|
| PubChem CID | 102297137 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2E,4R)-4-(methoxymethoxy)octa-2,7-dien-1-ol |
| SMILES | C=CCC[C@H](/C=C/CO)OCOC |
| InChI | InChI=1S/C10H18O3/c1-3-4-6-10(7-5-8-11)13-9-12-2/h3,5,7,10-11H,1,4,6,8-9H2,2H3/b7-5+/t10-/m1/s1 |
| InChIKey | CXAXOGNDYPZJMG-BREXMAIKSA-N |
| XLogP | 1.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|