C15H30O3 — CID 56650372
(E,4S)-4-(methoxymethoxy)tridec-2-en-1-ol (PubChem CID 56650372) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is (E,4S)-4-(methoxymethoxy)tridec-2-en-1-ol.
| Compound Name | (E,4S)-4-(methoxymethoxy)tridec-2-en-1-ol |
|---|---|
| PubChem CID | 56650372 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | (E,4S)-4-(methoxymethoxy)tridec-2-en-1-ol |
| SMILES | CCCCCCCCC[C@@H](/C=C/CO)OCOC |
| InChI | InChI=1S/C15H30O3/c1-3-4-5-6-7-8-9-11-15(12-10-13-16)18-14-17-2/h10,12,15-16H,3-9,11,13-14H2,1-2H3/b12-10+/t15-/m0/s1 |
| InChIKey | PIAMGSSFXCAWIV-PABFRNLHSA-N |
| XLogP | 3.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|