About 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine
3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine (PubChem CID 10035109) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine.
Molecular Properties
| Compound Name | 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine |
| PubChem CID | 10035109 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine |
| SMILES | CN1CCN=C1Cc1cccnc1 |
| InChI | InChI=1S/C10H13N3/c1-13-6-5-12-10(13)7-9-3-2-4-11-8-9/h2-4,8H,5-7H2,1H3 |
| InChIKey | YXPIBYSOCFGTHG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine?
The IUPAC name of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine (CID 10035109) is 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine.
What is the SMILES notation for 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine?
The canonical SMILES for 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine is CN1CCN=C1Cc1cccnc1.
What is the InChIKey of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine?
The InChIKey is YXPIBYSOCFGTHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-13-6-5-12-10(13)7-9-3-2-4-11-8-9/h2-4,8H,5-7H2,1H3.
What are the key properties of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine?
3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine has a molecular weight of 175.24 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]pyridine is sourced from PubChem (CID 10035109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).