C12H15NO3 — CID 10036457
(3R,4R)-3,4-dihydroxy-1-methyl-6-phenylpiperidin-2-one (PubChem CID 10036457) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (3R,4R)-3,4-dihydroxy-1-methyl-6-phenylpiperidin-2-one.
| Compound Name | (3R,4R)-3,4-dihydroxy-1-methyl-6-phenylpiperidin-2-one |
|---|---|
| PubChem CID | 10036457 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (3R,4R)-3,4-dihydroxy-1-methyl-6-phenylpiperidin-2-one |
| SMILES | CN1C(=O)[C@H](O)[C@H](O)CC1c1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c1-13-9(8-5-3-2-4-6-8)7-10(14)11(15)12(13)16/h2-6,9-11,14-15H,7H2,1H3/t9?,10-,11-/m1/s1 |
| InChIKey | FACWILWCPPILAT-FHZGLPGMSA-N |
| XLogP | 0.31 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |