C14H17NO4 — CID 71661156
(3S,4R)-3,4-dihydroxy-1-(3-phenylpropanoyl)piperidin-2-one (PubChem CID 71661156) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (3S,4R)-3,4-dihydroxy-1-(3-phenylpropanoyl)piperidin-2-one.
| Compound Name | (3S,4R)-3,4-dihydroxy-1-(3-phenylpropanoyl)piperidin-2-one |
|---|---|
| PubChem CID | 71661156 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (3S,4R)-3,4-dihydroxy-1-(3-phenylpropanoyl)piperidin-2-one |
| SMILES | O=C(CCc1ccccc1)N1CC[C@@H](O)[C@H](O)C1=O |
| InChI | InChI=1S/C14H17NO4/c16-11-8-9-15(14(19)13(11)18)12(17)7-6-10-4-2-1-3-5-10/h1-5,11,13,16,18H,6-9H2/t11-,13+/m1/s1 |
| InChIKey | JYOKZZBTMGNMFG-YPMHNXCESA-N |
| XLogP | 0.10 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |