C13H12N4O — CID 10037288
4-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)benzonitrile (PubChem CID 10037288) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 4-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)benzonitrile.
| Compound Name | 4-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 10037288 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-(3-pyrrolidin-1-yl-1,2,4-oxadiazol-5-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(N3CCCC3)no2)cc1 |
| InChI | InChI=1S/C13H12N4O/c14-9-10-3-5-11(6-4-10)12-15-13(16-18-12)17-7-1-2-8-17/h3-6H,1-2,7-8H2 |
| InChIKey | XINOKHJWDBWGIJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |