C17H28O — CID 10037668
(6R,7S)-6-ethenyl-2,6-dimethyltridec-2-en-8-yn-7-ol (PubChem CID 10037668) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (6R,7S)-6-ethenyl-2,6-dimethyltridec-2-en-8-yn-7-ol.
| Compound Name | (6R,7S)-6-ethenyl-2,6-dimethyltridec-2-en-8-yn-7-ol |
|---|---|
| PubChem CID | 10037668 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (6R,7S)-6-ethenyl-2,6-dimethyltridec-2-en-8-yn-7-ol |
| SMILES | C=C[C@@](C)(CCC=C(C)C)[C@H](O)C#CCCCC |
| InChI | InChI=1S/C17H28O/c1-6-8-9-10-13-16(18)17(5,7-2)14-11-12-15(3)4/h7,12,16,18H,2,6,8-9,11,14H2,1,3-5H3/t16-,17+/m1/s1 |
| InChIKey | OCUCWLYCUPKZJT-SJORKVTESA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|