C11H6F3NOS — CID 10038071
1,3-thiazol-2-yl-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 10038071) has the molecular formula C11H6F3NOS and a molecular weight of 257.24 g/mol. Its IUPAC name is 1,3-thiazol-2-yl-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | 1,3-thiazol-2-yl-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 10038071 |
| Molecular Formula | C11H6F3NOS |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 1,3-thiazol-2-yl-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)c1nccs1 |
| InChI | InChI=1S/C11H6F3NOS/c12-11(13,14)8-3-1-7(2-4-8)9(16)10-15-5-6-17-10/h1-6H |
| InChIKey | BORIWFQCOOGTGH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |