C16H22O3 — CID 10038353
methyl (E,8E)-8-(2-formylcyclohex-2-en-1-ylidene)oct-2-enoate (PubChem CID 10038353) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl (E,8E)-8-(2-formylcyclohex-2-en-1-ylidene)oct-2-enoate.
| Compound Name | methyl (E,8E)-8-(2-formylcyclohex-2-en-1-ylidene)oct-2-enoate |
|---|---|
| PubChem CID | 10038353 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl (E,8E)-8-(2-formylcyclohex-2-en-1-ylidene)oct-2-enoate |
| SMILES | COC(=O)/C=C/CCCC/C=C1\CCCC=C1C=O |
| InChI | InChI=1S/C16H22O3/c1-19-16(18)12-6-4-2-3-5-9-14-10-7-8-11-15(14)13-17/h6,9,11-13H,2-5,7-8,10H2,1H3/b12-6+,14-9+ |
| InChIKey | JBBQZBPQRBPWGT-WZGXVBCRSA-N |
| XLogP | 3.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|