C21H21F3O2 — CID 143772976
4-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3-fluorocyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 143772976) has the molecular formula C21H21F3O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3-fluorocyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 4-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3-fluorocyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 143772976 |
| Molecular Formula | C21H21F3O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3-fluorocyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | C=C(/C=C\C(=C)C1=C(F)C=C(C=O)CC1)C(=C)/C(F)=C(\F)C(=C)OCC |
| InChI | InChI=1S/C21H21F3O2/c1-6-26-16(5)21(24)20(23)15(4)13(2)7-8-14(3)18-10-9-17(12-25)11-19(18)22/h7-8,11-12H,2-6,9-10H2,1H3/b8-7-,21-20- |
| InChIKey | VBFRAUMZQYONJQ-OQFOSPAESA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|