C9H9F3O2 — CID 163550405
2-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 163550405) has the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. Its IUPAC name is 2-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 2-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 163550405 |
| Molecular Formula | C9H9F3O2 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | COC1=C(C=O)CCC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C9H9F3O2/c1-14-8-4-7(9(10,11)12)3-2-6(8)5-13/h4-5H,2-3H2,1H3 |
| InChIKey | FIOSXHLWZDHPBI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|