C11H13FO2 — CID 143713023
2-(3-fluoro-4-methoxy-6-methylcyclohepta-1,3,5-trien-1-yl)acetaldehyde (PubChem CID 143713023) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxy-6-methylcyclohepta-1,3,5-trien-1-yl)acetaldehyde.
| Compound Name | 2-(3-fluoro-4-methoxy-6-methylcyclohepta-1,3,5-trien-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 143713023 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 2-(3-fluoro-4-methoxy-6-methylcyclohepta-1,3,5-trien-1-yl)acetaldehyde |
| SMILES | COC1=C(F)C=C(CC=O)CC(C)=C1 |
| InChI | InChI=1S/C11H13FO2/c1-8-5-9(3-4-13)7-10(12)11(6-8)14-2/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | RHPHBVWEPXNEME-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|