C11H14O2 — CID 90806246
4-methyl-2-prop-2-enoxycyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 90806246) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-methyl-2-prop-2-enoxycyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 4-methyl-2-prop-2-enoxycyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 90806246 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 4-methyl-2-prop-2-enoxycyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | C=CCOC1=C(C=O)CCC(C)=C1 |
| InChI | InChI=1S/C11H14O2/c1-3-6-13-11-7-9(2)4-5-10(11)8-12/h3,7-8H,1,4-6H2,2H3 |
| InChIKey | NWQVGYNVCOTIEQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|