C15H24O3 — CID 91483356
(6E)-8-methoxy-2-oxo-6-propylundeca-6,8-dienal (PubChem CID 91483356) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (6E)-8-methoxy-2-oxo-6-propylundeca-6,8-dienal.
| Compound Name | (6E)-8-methoxy-2-oxo-6-propylundeca-6,8-dienal |
|---|---|
| PubChem CID | 91483356 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (6E)-8-methoxy-2-oxo-6-propylundeca-6,8-dienal |
| SMILES | CCC=C(/C=C(\CCC)CCCC(=O)C=O)OC |
| InChI | InChI=1S/C15H24O3/c1-4-7-13(9-6-10-14(17)12-16)11-15(18-3)8-5-2/h8,11-12H,4-7,9-10H2,1-3H3/b13-11+,15-8? |
| InChIKey | BICCSRZOHUABIJ-VRFCRGODSA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|