About 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde
2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 89275415) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 89275415 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | COC1=C(C=O)C(OC)CC(C)=C1 |
| InChI | InChI=1S/C10H14O3/c1-7-4-9(12-2)8(6-11)10(5-7)13-3/h4,6,10H,5H2,1-3H3 |
| InChIKey | QQKIIDZYZJTQBT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde (CID 89275415) is 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde is COC1=C(C=O)C(OC)CC(C)=C1.
What is the InChIKey of 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is QQKIIDZYZJTQBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-7-4-9(12-2)8(6-11)10(5-7)13-3/h4,6,10H,5H2,1-3H3.
What are the key properties of 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde?
2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 182.22 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethoxy-4-methylcyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 89275415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).