C17H20O4 — CID 10039743
[(1E)-4-(methoxymethoxy)-2-methyl-1-phenylhexa-1,4,5-trien-3-yl] acetate (PubChem CID 10039743) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is [(1E)-4-(methoxymethoxy)-2-methyl-1-phenylhexa-1,4,5-trien-3-yl] acetate.
| Compound Name | [(1E)-4-(methoxymethoxy)-2-methyl-1-phenylhexa-1,4,5-trien-3-yl] acetate |
|---|---|
| PubChem CID | 10039743 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [(1E)-4-(methoxymethoxy)-2-methyl-1-phenylhexa-1,4,5-trien-3-yl] acetate |
| SMILES | C=C=C(OCOC)C(OC(C)=O)/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C17H20O4/c1-5-16(20-12-19-4)17(21-14(3)18)13(2)11-15-9-7-6-8-10-15/h6-11,17H,1,12H2,2-4H3/b13-11+ |
| InChIKey | YEUBKVSKLRXGSM-ACCUITESSA-N |
| XLogP | 3.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|