C15H11NO4S — CID 10040515
N-(9,10,10-trioxothioxanthen-2-yl)acetamide (PubChem CID 10040515) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is N-(9,10,10-trioxothioxanthen-2-yl)acetamide.
| Compound Name | N-(9,10,10-trioxothioxanthen-2-yl)acetamide |
|---|---|
| PubChem CID | 10040515 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | N-(9,10,10-trioxothioxanthen-2-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)C(=O)c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C15H11NO4S/c1-9(17)16-10-6-7-14-12(8-10)15(18)11-4-2-3-5-13(11)21(14,19)20/h2-8H,1H3,(H,16,17) |
| InChIKey | WUMSWKQZBOVGMV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |