C17H18N2O4S2 — CID 2211711
N-[4-(acetylsulfamoyl)phenyl]-2-ethylsulfanylbenzamide (PubChem CID 2211711) has the molecular formula C17H18N2O4S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2-ethylsulfanylbenzamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2-ethylsulfanylbenzamide |
|---|---|
| PubChem CID | 2211711 |
| Molecular Formula | C17H18N2O4S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2-ethylsulfanylbenzamide |
| SMILES | CCSc1ccccc1C(=O)Nc1ccc(S(=O)(=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C17H18N2O4S2/c1-3-24-16-7-5-4-6-15(16)17(21)18-13-8-10-14(11-9-13)25(22,23)19-12(2)20/h4-11H,3H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | SXGPNCHPNUTKSZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |