C17H10F2O4 — CID 10041427
2-[2-(3,4-difluorophenyl)-2-oxoethyl]-2-hydroxyindene-1,3-dione (PubChem CID 10041427) has the molecular formula C17H10F2O4 and a molecular weight of 316.26 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)-2-oxoethyl]-2-hydroxyindene-1,3-dione.
| Compound Name | 2-[2-(3,4-difluorophenyl)-2-oxoethyl]-2-hydroxyindene-1,3-dione |
|---|---|
| PubChem CID | 10041427 |
| Molecular Formula | C17H10F2O4 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)-2-oxoethyl]-2-hydroxyindene-1,3-dione |
| SMILES | O=C(CC1(O)C(=O)c2ccccc2C1=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H10F2O4/c18-12-6-5-9(7-13(12)19)14(20)8-17(23)15(21)10-3-1-2-4-11(10)16(17)22/h1-7,23H,8H2 |
| InChIKey | CVJIOQYTBAQXII-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|