C14H19NO8 — CID 10042194
[(2R,3S,4R,6S)-3,4-diacetyloxy-6-cyano-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 10042194) has the molecular formula C14H19NO8 and a molecular weight of 329.31 g/mol. Its IUPAC name is [(2R,3S,4R,6S)-3,4-diacetyloxy-6-cyano-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,6S)-3,4-diacetyloxy-6-cyano-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10042194 |
| Molecular Formula | C14H19NO8 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [(2R,3S,4R,6S)-3,4-diacetyloxy-6-cyano-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@]1(C#N)C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C14H19NO8/c1-8(16)20-6-12-13(22-10(3)18)11(21-9(2)17)5-14(7-15,19-4)23-12/h11-13H,5-6H2,1-4H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | BKNWTMHFOWKMQH-MQYQWHSLSA-N |
| XLogP | 0.07 |
| TPSA | 121.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|