C25H25NO6 — CID 1004394
ethyl (3aS,4R,9bR)-4-(2,4-diacetyloxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 1004394) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is ethyl (3aS,4R,9bR)-4-(2,4-diacetyloxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | ethyl (3aS,4R,9bR)-4-(2,4-diacetyloxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 1004394 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | ethyl (3aS,4R,9bR)-4-(2,4-diacetyloxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1ccc(OC(C)=O)cc1OC(C)=O)N2 |
| InChI | InChI=1S/C25H25NO6/c1-4-30-25(29)16-8-11-22-21(12-16)18-6-5-7-19(18)24(26-22)20-10-9-17(31-14(2)27)13-23(20)32-15(3)28/h5-6,8-13,18-19,24,26H,4,7H2,1-3H3/t18-,19+,24-/m1/s1 |
| InChIKey | RGBNOSSQZDJADT-YDIMBITNSA-N |
| XLogP | 4.54 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|