C23H23NO4 — CID 7447757
[4-[(3aR,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-3-acetyloxyphenyl] acetate (PubChem CID 7447757) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is [4-[(3aR,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-3-acetyloxyphenyl] acetate.
| Compound Name | [4-[(3aR,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-3-acetyloxyphenyl] acetate |
|---|---|
| PubChem CID | 7447757 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [4-[(3aR,4R,9bR)-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-3-acetyloxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H]2Nc3ccc(C)cc3[C@@H]3C=CC[C@H]32)c(OC(C)=O)c1 |
| InChI | InChI=1S/C23H23NO4/c1-13-7-10-21-20(11-13)17-5-4-6-18(17)23(24-21)19-9-8-16(27-14(2)25)12-22(19)28-15(3)26/h4-5,7-12,17-18,23-24H,6H2,1-3H3/t17-,18-,23-/m1/s1 |
| InChIKey | UEIOBTMSWHXVOH-PMAPCBKXSA-N |
| XLogP | 4.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|