C20H23Cl2NO — CID 10044290
2-[(2S)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol (PubChem CID 10044290) has the molecular formula C20H23Cl2NO and a molecular weight of 364.32 g/mol. Its IUPAC name is 2-[(2S)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol.
| Compound Name | 2-[(2S)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 10044290 |
| Molecular Formula | C20H23Cl2NO |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-[(2S)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol |
| SMILES | OCC(c1ccc(Cl)c(Cl)c1)[C@@H]1CCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H23Cl2NO/c21-18-10-9-16(12-19(18)22)17(14-24)20-8-4-5-11-23(20)13-15-6-2-1-3-7-15/h1-3,6-7,9-10,12,17,20,24H,4-5,8,11,13-14H2/t17?,20-/m0/s1 |
| InChIKey | NRJOAYKSGZHTCR-OZBJMMHXSA-N |
| XLogP | 5.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |