C19H34O5Si — CID 10044693
[(E)-[(1S,2S,6S,7R,9R)-7-(1-ethoxyethoxy)-4,4-dimethyl-3,5,8-trioxatricyclo[7.3.0.02,6]dodecan-12-ylidene]methyl]-trimethylsilane (PubChem CID 10044693) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is [(E)-[(1S,2S,6S,7R,9R)-7-(1-ethoxyethoxy)-4,4-dimethyl-3,5,8-trioxatricyclo[7.3.0.02,6]dodecan-12-ylidene]methyl]-trimethylsilane.
| Compound Name | [(E)-[(1S,2S,6S,7R,9R)-7-(1-ethoxyethoxy)-4,4-dimethyl-3,5,8-trioxatricyclo[7.3.0.02,6]dodecan-12-ylidene]methyl]-trimethylsilane |
|---|---|
| PubChem CID | 10044693 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | [(E)-[(1S,2S,6S,7R,9R)-7-(1-ethoxyethoxy)-4,4-dimethyl-3,5,8-trioxatricyclo[7.3.0.02,6]dodecan-12-ylidene]methyl]-trimethylsilane |
| SMILES | CCOC(C)O[C@H]1O[C@@H]2CC/C(=C\[Si](C)(C)C)[C@@H]2[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C19H34O5Si/c1-8-20-12(2)21-18-17-16(23-19(3,4)24-17)15-13(11-25(5,6)7)9-10-14(15)22-18/h11-12,14-18H,8-10H2,1-7H3/b13-11+/t12?,14-,15+,16+,17+,18+/m1/s1 |
| InChIKey | LOLLLVTXWPMWOD-JTEIHXOXSA-N |
| XLogP | 3.84 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|