C29H58O4SiSn — CID 10746394
[(3Z,3aR,5S,7R,7aS)-5-ethoxy-3-(tributylstannylmethylidene)-4,5,7,7a-tetrahydro-3aH-furo[2,3-c]pyran-7-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10746394) has the molecular formula C29H58O4SiSn and a molecular weight of 617.58 g/mol. Its IUPAC name is [(3Z,3aR,5S,7R,7aS)-5-ethoxy-3-(tributylstannylmethylidene)-4,5,7,7a-tetrahydro-3aH-furo[2,3-c]pyran-7-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3Z,3aR,5S,7R,7aS)-5-ethoxy-3-(tributylstannylmethylidene)-4,5,7,7a-tetrahydro-3aH-furo[2,3-c]pyran-7-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10746394 |
| Molecular Formula | C29H58O4SiSn |
| Molecular Weight | 617.58 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | [(3Z,3aR,5S,7R,7aS)-5-ethoxy-3-(tributylstannylmethylidene)-4,5,7,7a-tetrahydro-3aH-furo[2,3-c]pyran-7-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CCCC[Sn](/C=C1\CO[C@H]2[C@@H]1C[C@@H](OCC)O[C@@H]2CO[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C17H31O4Si.3C4H9.Sn/c1-8-18-15-9-13-12(2)10-19-16(13)14(21-15)11-20-22(6,7)17(3,4)5;3*1-3-4-2;/h2,13-16H,8-11H2,1,3-7H3;3*1,3-4H2,2H3;/t13-,14-,15+,16+;;;;/m1..../s1 |
| InChIKey | UPPXBKSKNWGQSX-CHYRLJQLSA-N |
| XLogP | 8.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.58 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|